C21H35BO2Si — CID 100945364
[2,4-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-3-en-2-yl]-dimethyl-phenylsilane (PubChem CID 100945364) has the molecular formula C21H35BO2Si and a molecular weight of 358.41 g/mol. Its IUPAC name is [2,4-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-3-en-2-yl]-dimethyl-phenylsilane.
| Compound Name | [2,4-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-3-en-2-yl]-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 100945364 |
| Molecular Formula | C21H35BO2Si |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | [2,4-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-3-en-2-yl]-dimethyl-phenylsilane |
| SMILES | CC(C)=C(B1OC(C)(C)C(C)(C)O1)C(C)(C)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C21H35BO2Si/c1-16(2)18(22-23-20(5,6)21(7,8)24-22)19(3,4)25(9,10)17-14-12-11-13-15-17/h11-15H,1-10H3 |
| InChIKey | HADKIAGFACKQAB-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|