C25H45BO3Si2 — CID 135060739
tert-butyl-[(2R)-2-[dimethyl(phenyl)silyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enoxy]-dimethylsilane (PubChem CID 135060739) has the molecular formula C25H45BO3Si2 and a molecular weight of 460.62 g/mol. Its IUPAC name is tert-butyl-[(2R)-2-[dimethyl(phenyl)silyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2R)-2-[dimethyl(phenyl)silyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 135060739 |
| Molecular Formula | C25H45BO3Si2 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.30 |
| IUPAC Name | tert-butyl-[(2R)-2-[dimethyl(phenyl)silyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enoxy]-dimethylsilane |
| SMILES | C=C(C[C@H](CO[Si](C)(C)C(C)(C)C)[Si](C)(C)c1ccccc1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C25H45BO3Si2/c1-20(26-28-24(5,6)25(7,8)29-26)18-22(19-27-31(11,12)23(2,3)4)30(9,10)21-16-14-13-15-17-21/h13-17,22H,1,18-19H2,2-12H3/t22-/m1/s1 |
| InChIKey | UVFCQBCANLXYBT-JOCHJYFZSA-N |
| XLogP | 6.57 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|