C20H33BO2Si — CID 135049091
dimethyl-phenyl-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-1-en-3-yl]silane (PubChem CID 135049091) has the molecular formula C20H33BO2Si and a molecular weight of 344.38 g/mol. Its IUPAC name is dimethyl-phenyl-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-1-en-3-yl]silane.
| Compound Name | dimethyl-phenyl-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-1-en-3-yl]silane |
|---|---|
| PubChem CID | 135049091 |
| Molecular Formula | C20H33BO2Si |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.23 |
| IUPAC Name | dimethyl-phenyl-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-1-en-3-yl]silane |
| SMILES | C=C(B1OC(C)(C)C(C)(C)O1)C(CCC)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C20H33BO2Si/c1-9-13-18(24(7,8)17-14-11-10-12-15-17)16(2)21-22-19(3,4)20(5,6)23-21/h10-12,14-15,18H,2,9,13H2,1,3-8H3 |
| InChIKey | VFZFOVXBVDORAA-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|