C20H29BO4S — CID 102584680
2-[3-(benzenesulfonyl)octa-1,7-dien-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 102584680) has the molecular formula C20H29BO4S and a molecular weight of 376.33 g/mol. Its IUPAC name is 2-[3-(benzenesulfonyl)octa-1,7-dien-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[3-(benzenesulfonyl)octa-1,7-dien-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 102584680 |
| Molecular Formula | C20H29BO4S |
| Molecular Weight | 376.33 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 2-[3-(benzenesulfonyl)octa-1,7-dien-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | C=CCCCC(C(=C)B1OC(C)(C)C(C)(C)O1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H29BO4S/c1-7-8-10-15-18(26(22,23)17-13-11-9-12-14-17)16(2)21-24-19(3,4)20(5,6)25-21/h7,9,11-14,18H,1-2,8,10,15H2,3-6H3 |
| InChIKey | KLBOBCMBCMLQEY-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.33 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|