About sodium;benzenesulfonic acid;dodec-1-ene
sodium;benzenesulfonic acid;dodec-1-ene (PubChem CID 87233475) has the molecular formula C18H29NaO3S
and a molecular weight of 348.48 g/mol. Its IUPAC name is sodium;benzenesulfonic acid;dodec-1-ene.
Molecular Properties
| Compound Name | sodium;benzenesulfonic acid;dodec-1-ene |
| PubChem CID | 87233475 |
| Molecular Formula | C18H29NaO3S |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | sodium;benzenesulfonic acid;dodec-1-ene |
| SMILES | C=CCCCCCCCCC[CH2-].O=S(=O)(O)c1ccccc1.[Na+] |
| InChI | InChI=1S/C12H23.C6H6O3S.Na/c1-3-5-7-9-11-12-10-8-6-4-2;7-10(8,9)6-4-2-1-3-5-6;/h3H,1-2,4-12H2;1-5H,(H,7,8,9);/q-1;;+1 |
| InChIKey | NYCNXJPAFIAWQW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;benzenesulfonic acid;dodec-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;benzenesulfonic acid;dodec-1-ene?
The IUPAC name of sodium;benzenesulfonic acid;dodec-1-ene (CID 87233475) is sodium;benzenesulfonic acid;dodec-1-ene.
What is the SMILES notation for sodium;benzenesulfonic acid;dodec-1-ene?
The canonical SMILES for sodium;benzenesulfonic acid;dodec-1-ene is C=CCCCCCCCCC[CH2-].O=S(=O)(O)c1ccccc1.[Na+].
What is the InChIKey of sodium;benzenesulfonic acid;dodec-1-ene?
The InChIKey is NYCNXJPAFIAWQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23.C6H6O3S.Na/c1-3-5-7-9-11-12-10-8-6-4-2;7-10(8,9)6-4-2-1-3-5-6;/h3H,1-2,4-12H2;1-5H,(H,7,8,9);/q-1;;+1.
What are the key properties of sodium;benzenesulfonic acid;dodec-1-ene?
sodium;benzenesulfonic acid;dodec-1-ene has a molecular weight of 348.48 g/mol, XLogP of 2.45, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;benzenesulfonic acid;dodec-1-ene is sourced from PubChem (CID 87233475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).