About sodium;benzenesulfonic acid;chloroethane
sodium;benzenesulfonic acid;chloroethane (PubChem CID 175093341) has the molecular formula C8H10ClNaO3S
and a molecular weight of 244.67 g/mol. Its IUPAC name is sodium;benzenesulfonic acid;chloroethane.
Molecular Properties
| Compound Name | sodium;benzenesulfonic acid;chloroethane |
| PubChem CID | 175093341 |
| Molecular Formula | C8H10ClNaO3S |
| Molecular Weight | 244.67 g/mol |
| Exact Mass | 243.99 |
| IUPAC Name | sodium;benzenesulfonic acid;chloroethane |
| SMILES | O=S(=O)(O)c1ccccc1.[CH2-]CCl.[Na+] |
| InChI | InChI=1S/C6H6O3S.C2H4Cl.Na/c7-10(8,9)6-4-2-1-3-5-6;1-2-3;/h1-5H,(H,7,8,9);1-2H2;/q;-1;+1 |
| InChIKey | UGDPMYDZXWDDDF-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.67 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;benzenesulfonic acid;chloroethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;benzenesulfonic acid;chloroethane?
The IUPAC name of sodium;benzenesulfonic acid;chloroethane (CID 175093341) is sodium;benzenesulfonic acid;chloroethane.
What is the SMILES notation for sodium;benzenesulfonic acid;chloroethane?
The canonical SMILES for sodium;benzenesulfonic acid;chloroethane is O=S(=O)(O)c1ccccc1.[CH2-]CCl.[Na+].
What is the InChIKey of sodium;benzenesulfonic acid;chloroethane?
The InChIKey is UGDPMYDZXWDDDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O3S.C2H4Cl.Na/c7-10(8,9)6-4-2-1-3-5-6;1-2-3;/h1-5H,(H,7,8,9);1-2H2;/q;-1;+1.
What are the key properties of sodium;benzenesulfonic acid;chloroethane?
sodium;benzenesulfonic acid;chloroethane has a molecular weight of 244.67 g/mol, XLogP of -1.00, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;benzenesulfonic acid;chloroethane is sourced from PubChem (CID 175093341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).