C22H34B2O4 — CID 101369795
4,4,5,5-tetramethyl-2-[(2R)-1-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-en-2-yl]-1,3,2-dioxaborolane (PubChem CID 101369795) has the molecular formula C22H34B2O4 and a molecular weight of 384.13 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[(2R)-1-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-en-2-yl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[(2R)-1-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-en-2-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 101369795 |
| Molecular Formula | C22H34B2O4 |
| Molecular Weight | 384.13 g/mol |
| Exact Mass | 384.26 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[(2R)-1-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-en-2-yl]-1,3,2-dioxaborolane |
| SMILES | C=C(B1OC(C)(C)C(C)(C)O1)[C@@H](Cc1ccccc1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C22H34B2O4/c1-16(23-25-19(2,3)20(4,5)26-23)18(15-17-13-11-10-12-14-17)24-27-21(6,7)22(8,9)28-24/h10-14,18H,1,15H2,2-9H3/t18-/m1/s1 |
| InChIKey | OLZIJBJLEUNXKZ-GOSISDBHSA-N |
| XLogP | 4.88 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.13 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|