C25H38B2O4 — CID 122398650
4,4,5,5-tetramethyl-2-[(3Z)-5-methyl-1-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexa-3,5-dien-3-yl]-1,3,2-dioxaborolane (PubChem CID 122398650) has the molecular formula C25H38B2O4 and a molecular weight of 424.20 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[(3Z)-5-methyl-1-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexa-3,5-dien-3-yl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[(3Z)-5-methyl-1-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexa-3,5-dien-3-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 122398650 |
| Molecular Formula | C25H38B2O4 |
| Molecular Weight | 424.20 g/mol |
| Exact Mass | 424.30 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[(3Z)-5-methyl-1-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexa-3,5-dien-3-yl]-1,3,2-dioxaborolane |
| SMILES | C=C(C)/C(B1OC(C)(C)C(C)(C)O1)=C(\CCc1ccccc1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C25H38B2O4/c1-18(2)21(27-30-24(7,8)25(9,10)31-27)20(17-16-19-14-12-11-13-15-19)26-28-22(3,4)23(5,6)29-26/h11-15H,1,16-17H2,2-10H3/b21-20- |
| InChIKey | DNMOVIYUOUVBSY-MRCUWXFGSA-N |
| XLogP | 5.75 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.20 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|