C19H31B2NO4 — CID 132579515
N-benzyl-4,4,5,5-tetramethyl-N-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,2-dioxaborolan-2-amine (PubChem CID 132579515) has the molecular formula C19H31B2NO4 and a molecular weight of 359.08 g/mol. Its IUPAC name is N-benzyl-4,4,5,5-tetramethyl-N-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,2-dioxaborolan-2-amine.
| Compound Name | N-benzyl-4,4,5,5-tetramethyl-N-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,2-dioxaborolan-2-amine |
|---|---|
| PubChem CID | 132579515 |
| Molecular Formula | C19H31B2NO4 |
| Molecular Weight | 359.08 g/mol |
| Exact Mass | 359.24 |
| IUPAC Name | N-benzyl-4,4,5,5-tetramethyl-N-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,2-dioxaborolan-2-amine |
| SMILES | CC1(C)OB(N(Cc2ccccc2)B2OC(C)(C)C(C)(C)O2)OC1(C)C |
| InChI | InChI=1S/C19H31B2NO4/c1-16(2)17(3,4)24-20(23-16)22(14-15-12-10-9-11-13-15)21-25-18(5,6)19(7,8)26-21/h9-13H,14H2,1-8H3 |
| InChIKey | IZMKCLVLNZMRMW-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.08 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|