C27H36BNO2 — CID 138984460
N,N-dibenzyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)bicyclo[2.2.1]heptan-2-amine (PubChem CID 138984460) has the molecular formula C27H36BNO2 and a molecular weight of 417.40 g/mol. Its IUPAC name is N,N-dibenzyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)bicyclo[2.2.1]heptan-2-amine.
| Compound Name | N,N-dibenzyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)bicyclo[2.2.1]heptan-2-amine |
|---|---|
| PubChem CID | 138984460 |
| Molecular Formula | C27H36BNO2 |
| Molecular Weight | 417.40 g/mol |
| Exact Mass | 417.28 |
| IUPAC Name | N,N-dibenzyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)bicyclo[2.2.1]heptan-2-amine |
| SMILES | CC1(C)OB(C2C3CCC(C3)C2N(Cc2ccccc2)Cc2ccccc2)OC1(C)C |
| InChI | InChI=1S/C27H36BNO2/c1-26(2)27(3,4)31-28(30-26)24-22-15-16-23(17-22)25(24)29(18-20-11-7-5-8-12-20)19-21-13-9-6-10-14-21/h5-14,22-25H,15-19H2,1-4H3 |
| InChIKey | TUOQOXLFBLXPEF-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.40 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|