C18H24BNO2 — CID 123570440
6-benzyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydropyridine (PubChem CID 123570440) has the molecular formula C18H24BNO2 and a molecular weight of 297.21 g/mol. Its IUPAC name is 6-benzyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydropyridine.
| Compound Name | 6-benzyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydropyridine |
|---|---|
| PubChem CID | 123570440 |
| Molecular Formula | C18H24BNO2 |
| Molecular Weight | 297.21 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | 6-benzyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydropyridine |
| SMILES | CC1(C)OB(C2C=CC(Cc3ccccc3)=NC2)OC1(C)C |
| InChI | InChI=1S/C18H24BNO2/c1-17(2)18(3,4)22-19(21-17)15-10-11-16(20-13-15)12-14-8-6-5-7-9-14/h5-11,15H,12-13H2,1-4H3 |
| InChIKey | KIRPRDHRERNBSV-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.21 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|