C12H13N — CID 69174847
6-benzyl-2,3-dihydropyridine (PubChem CID 69174847) has the molecular formula C12H13N and a molecular weight of 171.24 g/mol. Its IUPAC name is 6-benzyl-2,3-dihydropyridine.
| Compound Name | 6-benzyl-2,3-dihydropyridine |
|---|---|
| PubChem CID | 69174847 |
| Molecular Formula | C12H13N |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | 6-benzyl-2,3-dihydropyridine |
| SMILES | C1=CC(Cc2ccccc2)=NCC1 |
| InChI | InChI=1S/C12H13N/c1-2-6-11(7-3-1)10-12-8-4-5-9-13-12/h1-4,6-8H,5,9-10H2 |
| InChIKey | GKOAPHURVNPQIE-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |