C9H13NO — CID 134570591
4-(2,3-dihydropyridin-6-yl)butan-2-one (PubChem CID 134570591) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is 4-(2,3-dihydropyridin-6-yl)butan-2-one.
| Compound Name | 4-(2,3-dihydropyridin-6-yl)butan-2-one |
|---|---|
| PubChem CID | 134570591 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 4-(2,3-dihydropyridin-6-yl)butan-2-one |
| SMILES | CC(=O)CCC1=NCCC=C1 |
| InChI | InChI=1S/C9H13NO/c1-8(11)5-6-9-4-2-3-7-10-9/h2,4H,3,5-7H2,1H3 |
| InChIKey | MIIJWUAHWGSGLF-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |