C9H13NO — CID 91357305
1-(5-ethyl-2,3-dihydropyridin-6-yl)ethanone (PubChem CID 91357305) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is 1-(5-ethyl-2,3-dihydropyridin-6-yl)ethanone.
| Compound Name | 1-(5-ethyl-2,3-dihydropyridin-6-yl)ethanone |
|---|---|
| PubChem CID | 91357305 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 1-(5-ethyl-2,3-dihydropyridin-6-yl)ethanone |
| SMILES | CCC1=CCCN=C1C(C)=O |
| InChI | InChI=1S/C9H13NO/c1-3-8-5-4-6-10-9(8)7(2)11/h5H,3-4,6H2,1-2H3 |
| InChIKey | REBQXKAVFDZNQM-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |