About 1-(5-prop-1-en-2-yl-2,3-dihydropyridin-6-yl)ethanone
1-(5-prop-1-en-2-yl-2,3-dihydropyridin-6-yl)ethanone (PubChem CID 123478166) has the molecular formula C10H13NO
and a molecular weight of 163.22 g/mol. Its IUPAC name is 1-(5-prop-1-en-2-yl-2,3-dihydropyridin-6-yl)ethanone.
Analyze 1-(5-prop-1-en-2-yl-2,3-dihydropyridin-6-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-prop-1-en-2-yl-2,3-dihydropyridin-6-yl)ethanone?
The IUPAC name of 1-(5-prop-1-en-2-yl-2,3-dihydropyridin-6-yl)ethanone (CID 123478166) is 1-(5-prop-1-en-2-yl-2,3-dihydropyridin-6-yl)ethanone.
What is the SMILES notation for 1-(5-prop-1-en-2-yl-2,3-dihydropyridin-6-yl)ethanone?
The canonical SMILES for 1-(5-prop-1-en-2-yl-2,3-dihydropyridin-6-yl)ethanone is C=C(C)C1=CCCN=C1C(C)=O.
What is the InChIKey of 1-(5-prop-1-en-2-yl-2,3-dihydropyridin-6-yl)ethanone?
The InChIKey is NVADZAUTRSNVNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO/c1-7(2)9-5-4-6-11-10(9)8(3)12/h5H,1,4,6H2,2-3H3.
What are the key properties of 1-(5-prop-1-en-2-yl-2,3-dihydropyridin-6-yl)ethanone?
1-(5-prop-1-en-2-yl-2,3-dihydropyridin-6-yl)ethanone has a molecular weight of 163.22 g/mol, XLogP of 1.92, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-prop-1-en-2-yl-2,3-dihydropyridin-6-yl)ethanone is sourced from PubChem (CID 123478166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).