About 1-benzyl-2,5-dihydrophosphole
1-benzyl-2,5-dihydrophosphole (PubChem CID 23279889) has the molecular formula C11H13P
and a molecular weight of 176.20 g/mol. Its IUPAC name is 1-benzyl-2,5-dihydrophosphole.
Molecular Properties
| Compound Name | 1-benzyl-2,5-dihydrophosphole |
| PubChem CID | 23279889 |
| Molecular Formula | C11H13P |
| Molecular Weight | 176.20 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 1-benzyl-2,5-dihydrophosphole |
| SMILES | C1=CCP(Cc2ccccc2)C1 |
| InChI | InChI=1S/C11H13P/c1-2-6-11(7-3-1)10-12-8-4-5-9-12/h1-7H,8-10H2 |
| InChIKey | PHHWBUOOXJISAH-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.20 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-2,5-dihydrophosphole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-2,5-dihydrophosphole?
The IUPAC name of 1-benzyl-2,5-dihydrophosphole (CID 23279889) is 1-benzyl-2,5-dihydrophosphole.
What is the SMILES notation for 1-benzyl-2,5-dihydrophosphole?
The canonical SMILES for 1-benzyl-2,5-dihydrophosphole is C1=CCP(Cc2ccccc2)C1.
What is the InChIKey of 1-benzyl-2,5-dihydrophosphole?
The InChIKey is PHHWBUOOXJISAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13P/c1-2-6-11(7-3-1)10-12-8-4-5-9-12/h1-7H,8-10H2.
What are the key properties of 1-benzyl-2,5-dihydrophosphole?
1-benzyl-2,5-dihydrophosphole has a molecular weight of 176.20 g/mol, XLogP of 3.24, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-2,5-dihydrophosphole is sourced from PubChem (CID 23279889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).