About dibenzyltin
dibenzyltin (PubChem CID 29345) has the molecular formula C14H14Sn
and a molecular weight of 300.98 g/mol. Its IUPAC name is dibenzyltin.
Molecular Properties
| Compound Name | dibenzyltin |
| PubChem CID | 29345 |
| Molecular Formula | C14H14Sn |
| Molecular Weight | 300.98 g/mol |
| Exact Mass | 302.01 |
| IUPAC Name | dibenzyltin |
| SMILES | c1ccc(C[Sn]Cc2ccccc2)cc1 |
| InChI | InChI=1S/2C7H7.Sn/c2*1-7-5-3-2-4-6-7;/h2*2-6H,1H2; |
| InChIKey | SVSRQMUJHHQAAX-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.98 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze dibenzyltin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibenzyltin?
The IUPAC name of dibenzyltin (CID 29345) is dibenzyltin.
What is the SMILES notation for dibenzyltin?
The canonical SMILES for dibenzyltin is c1ccc(C[Sn]Cc2ccccc2)cc1.
What is the InChIKey of dibenzyltin?
The InChIKey is SVSRQMUJHHQAAX-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H7.Sn/c2*1-7-5-3-2-4-6-7;/h2*2-6H,1H2;.
What are the key properties of dibenzyltin?
dibenzyltin has a molecular weight of 300.98 g/mol, XLogP of 3.09, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzyltin is sourced from PubChem (CID 29345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).