About bromocopper;dibenzylsulfanium
bromocopper;dibenzylsulfanium (PubChem CID 4542716) has the molecular formula C14H15BrCuS+
and a molecular weight of 358.79 g/mol. Its IUPAC name is bromocopper;dibenzylsulfanium.
Molecular Properties
| Compound Name | bromocopper;dibenzylsulfanium |
| PubChem CID | 4542716 |
| Molecular Formula | C14H15BrCuS+ |
| Molecular Weight | 358.79 g/mol |
| Exact Mass | 356.94 |
| IUPAC Name | bromocopper;dibenzylsulfanium |
| SMILES | [Cu]Br.c1ccc(C[SH+]Cc2ccccc2)cc1 |
| InChI | InChI=1S/C14H14S.BrH.Cu/c1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14;;/h1-10H,11-12H2;1H;/q;;+1 |
| InChIKey | VMYWTHZXMVQRAY-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.79 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze bromocopper;dibenzylsulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromocopper;dibenzylsulfanium?
The IUPAC name of bromocopper;dibenzylsulfanium (CID 4542716) is bromocopper;dibenzylsulfanium.
What is the SMILES notation for bromocopper;dibenzylsulfanium?
The canonical SMILES for bromocopper;dibenzylsulfanium is [Cu]Br.c1ccc(C[SH+]Cc2ccccc2)cc1.
What is the InChIKey of bromocopper;dibenzylsulfanium?
The InChIKey is VMYWTHZXMVQRAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14S.BrH.Cu/c1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14;;/h1-10H,11-12H2;1H;/q;;+1.
What are the key properties of bromocopper;dibenzylsulfanium?
bromocopper;dibenzylsulfanium has a molecular weight of 358.79 g/mol, XLogP of 4.04, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bromocopper;dibenzylsulfanium is sourced from PubChem (CID 4542716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).