benzylphosphanium chloride

C7H10ClP — CID 70121985

IUPACbenzylphosphanium chloride
SMILES[Cl-].[PH3+]Cc1ccccc1
InChIInChI=1S/C7H9P.ClH/c8-6-7-4-2-1-3-5-7;/h1-5H,6,8H2;1H
InChIKeyPDPWRESELRSVAE-UHFFFAOYSA-N
MW160.58 g/mol
LogP-1.20
Rot. Bonds1

About benzylphosphanium chloride

benzylphosphanium chloride (PubChem CID 70121985) has the molecular formula C7H10ClP and a molecular weight of 160.58 g/mol. Its IUPAC name is benzylphosphanium chloride.

Molecular Properties

Compound Namebenzylphosphanium chloride
PubChem CID70121985
Molecular FormulaC7H10ClP
Molecular Weight160.58 g/mol
Exact Mass160.02
IUPAC Namebenzylphosphanium chloride
SMILES[Cl-].[PH3+]Cc1ccccc1
InChIInChI=1S/C7H9P.ClH/c8-6-7-4-2-1-3-5-7;/h1-5H,6,8H2;1H
InChIKeyPDPWRESELRSVAE-UHFFFAOYSA-N
XLogP-1.20
TPSA0.00 Ų
H-Bond Donors
H-Bond Acceptors
Rotatable Bonds1
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500160.58
LogP ≤ 5-1.20
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 100

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze benzylphosphanium chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzylphosphanium chloride?
The IUPAC name of benzylphosphanium chloride (CID 70121985) is benzylphosphanium chloride.
What is the SMILES notation for benzylphosphanium chloride?
The canonical SMILES for benzylphosphanium chloride is [Cl-].[PH3+]Cc1ccccc1.
What is the InChIKey of benzylphosphanium chloride?
The InChIKey is PDPWRESELRSVAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9P.ClH/c8-6-7-4-2-1-3-5-7;/h1-5H,6,8H2;1H.
What are the key properties of benzylphosphanium chloride?
benzylphosphanium chloride has a molecular weight of 160.58 g/mol, XLogP of -1.20, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzylphosphanium chloride is sourced from PubChem (CID 70121985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).