About benzylphosphanium;bis(palladium(2+))
benzylphosphanium;bis(palladium(2+)) (PubChem CID 175706897) has the molecular formula C7H10PPd2+5
and a molecular weight of 337.97 g/mol. Its IUPAC name is benzylphosphanium;bis(palladium(2+)).
Molecular Properties
| Compound Name | benzylphosphanium;bis(palladium(2+)) |
| PubChem CID | 175706897 |
| Molecular Formula | C7H10PPd2+5 |
| Molecular Weight | 337.97 g/mol |
| Exact Mass | 336.86 |
| IUPAC Name | benzylphosphanium;bis(palladium(2+)) |
| SMILES | [PH3+]Cc1ccccc1.[Pd+2].[Pd+2] |
| InChI | InChI=1S/C7H9P.2Pd/c8-6-7-4-2-1-3-5-7;;/h1-5H,6,8H2;;/q;2*+2/p+1 |
| InChIKey | ODQJEORORGMDCB-UHFFFAOYSA-O |
| XLogP | 1.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.97 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze benzylphosphanium;bis(palladium(2+)) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzylphosphanium;bis(palladium(2+))?
The IUPAC name of benzylphosphanium;bis(palladium(2+)) (CID 175706897) is benzylphosphanium;bis(palladium(2+)).
What is the SMILES notation for benzylphosphanium;bis(palladium(2+))?
The canonical SMILES for benzylphosphanium;bis(palladium(2+)) is [PH3+]Cc1ccccc1.[Pd+2].[Pd+2].
What is the InChIKey of benzylphosphanium;bis(palladium(2+))?
The InChIKey is ODQJEORORGMDCB-UHFFFAOYSA-O. The full InChI is InChI=1S/C7H9P.2Pd/c8-6-7-4-2-1-3-5-7;;/h1-5H,6,8H2;;/q;2*+2/p+1.
What are the key properties of benzylphosphanium;bis(palladium(2+))?
benzylphosphanium;bis(palladium(2+)) has a molecular weight of 337.97 g/mol, XLogP of 1.79, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzylphosphanium;bis(palladium(2+)) is sourced from PubChem (CID 175706897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).