About 1-benzyl-4-phenyl-1,4-diphosphinine
1-benzyl-4-phenyl-1,4-diphosphinine (PubChem CID 13441113) has the molecular formula C17H16P2
and a molecular weight of 282.26 g/mol. Its IUPAC name is 1-benzyl-4-phenyl-1,4-diphosphinine.
Molecular Properties
| Compound Name | 1-benzyl-4-phenyl-1,4-diphosphinine |
| PubChem CID | 13441113 |
| Molecular Formula | C17H16P2 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 1-benzyl-4-phenyl-1,4-diphosphinine |
| SMILES | C1=CP(c2ccccc2)C=CP1Cc1ccccc1 |
| InChI | InChI=1S/C17H16P2/c1-3-7-16(8-4-1)15-18-11-13-19(14-12-18)17-9-5-2-6-10-17/h1-14H,15H2 |
| InChIKey | UKLJVNUBUBPWQA-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-4-phenyl-1,4-diphosphinine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-4-phenyl-1,4-diphosphinine?
The IUPAC name of 1-benzyl-4-phenyl-1,4-diphosphinine (CID 13441113) is 1-benzyl-4-phenyl-1,4-diphosphinine.
What is the SMILES notation for 1-benzyl-4-phenyl-1,4-diphosphinine?
The canonical SMILES for 1-benzyl-4-phenyl-1,4-diphosphinine is C1=CP(c2ccccc2)C=CP1Cc1ccccc1.
What is the InChIKey of 1-benzyl-4-phenyl-1,4-diphosphinine?
The InChIKey is UKLJVNUBUBPWQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16P2/c1-3-7-16(8-4-1)15-18-11-13-19(14-12-18)17-9-5-2-6-10-17/h1-14H,15H2.
What are the key properties of 1-benzyl-4-phenyl-1,4-diphosphinine?
1-benzyl-4-phenyl-1,4-diphosphinine has a molecular weight of 282.26 g/mol, XLogP of 5.43, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-4-phenyl-1,4-diphosphinine is sourced from PubChem (CID 13441113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).