C11H18BNO2 — CID 141444392
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydropyridine (PubChem CID 141444392) has the molecular formula C11H18BNO2 and a molecular weight of 207.08 g/mol. Its IUPAC name is 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydropyridine.
| Compound Name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydropyridine |
|---|---|
| PubChem CID | 141444392 |
| Molecular Formula | C11H18BNO2 |
| Molecular Weight | 207.08 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydropyridine |
| SMILES | CC1(C)OB(C2C=CN=CC2)OC1(C)C |
| InChI | InChI=1S/C11H18BNO2/c1-10(2)11(3,4)15-12(14-10)9-5-7-13-8-6-9/h5,7-9H,6H2,1-4H3 |
| InChIKey | WGFAUGPSXYBZSO-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.08 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|