C12H20BNO2 — CID 175991227
2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,5-dihydropyridine (PubChem CID 175991227) has the molecular formula C12H20BNO2 and a molecular weight of 221.11 g/mol. Its IUPAC name is 2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,5-dihydropyridine.
| Compound Name | 2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,5-dihydropyridine |
|---|---|
| PubChem CID | 175991227 |
| Molecular Formula | C12H20BNO2 |
| Molecular Weight | 221.11 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | 2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,5-dihydropyridine |
| SMILES | CC1C=C(B2OC(C)(C)C(C)(C)O2)CC=N1 |
| InChI | InChI=1S/C12H20BNO2/c1-9-8-10(6-7-14-9)13-15-11(2,3)12(4,5)16-13/h7-9H,6H2,1-5H3 |
| InChIKey | XSOKANGZQYMRFS-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.11 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|