C12H22BNO2 — CID 174069837
N-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopent-3-en-1-amine (PubChem CID 174069837) has the molecular formula C12H22BNO2 and a molecular weight of 223.12 g/mol. Its IUPAC name is N-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopent-3-en-1-amine.
| Compound Name | N-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopent-3-en-1-amine |
|---|---|
| PubChem CID | 174069837 |
| Molecular Formula | C12H22BNO2 |
| Molecular Weight | 223.12 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | N-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopent-3-en-1-amine |
| SMILES | CNC1CC=C(B2OC(C)(C)C(C)(C)O2)C1 |
| InChI | InChI=1S/C12H22BNO2/c1-11(2)12(3,4)16-13(15-11)9-6-7-10(8-9)14-5/h6,10,14H,7-8H2,1-5H3 |
| InChIKey | GAMXHNQXDATLOC-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.12 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|