C19H26BNO3 — CID 149088320
N-[4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopent-3-en-1-yl]phenyl]acetamide (PubChem CID 149088320) has the molecular formula C19H26BNO3 and a molecular weight of 327.23 g/mol. Its IUPAC name is N-[4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopent-3-en-1-yl]phenyl]acetamide.
| Compound Name | N-[4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopent-3-en-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 149088320 |
| Molecular Formula | C19H26BNO3 |
| Molecular Weight | 327.23 g/mol |
| Exact Mass | 327.20 |
| IUPAC Name | N-[4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopent-3-en-1-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C2CC=C(B3OC(C)(C)C(C)(C)O3)C2)cc1 |
| InChI | InChI=1S/C19H26BNO3/c1-13(22)21-17-10-7-14(8-11-17)15-6-9-16(12-15)20-23-18(2,3)19(4,5)24-20/h7-11,15H,6,12H2,1-5H3,(H,21,22) |
| InChIKey | QRRPOGOQKBCVRY-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.23 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|