C16H29BO4S — CID 161015144
methyl (1S)-6,6-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-ene-1-carboxylate;sulfane (PubChem CID 161015144) has the molecular formula C16H29BO4S and a molecular weight of 328.28 g/mol. Its IUPAC name is methyl (1S)-6,6-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-ene-1-carboxylate;sulfane.
| Compound Name | methyl (1S)-6,6-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-ene-1-carboxylate;sulfane |
|---|---|
| PubChem CID | 161015144 |
| Molecular Formula | C16H29BO4S |
| Molecular Weight | 328.28 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | methyl (1S)-6,6-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-ene-1-carboxylate;sulfane |
| SMILES | COC(=O)[C@H]1CC(B2OC(C)(C)C(C)(C)O2)=CCC1(C)C.S |
| InChI | InChI=1S/C16H27BO4.H2S/c1-14(2)9-8-11(10-12(14)13(18)19-7)17-20-15(3,4)16(5,6)21-17;/h8,12H,9-10H2,1-7H3;1H2/t12-;/m1./s1 |
| InChIKey | TXPVUBBFZJZQHV-UTONKHPSSA-N |
| XLogP | 3.27 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.28 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|