C16H27BO4 — CID 140813852
methyl (1R)-6,6-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-ene-1-carboxylate (PubChem CID 140813852) has the molecular formula C16H27BO4 and a molecular weight of 294.20 g/mol. Its IUPAC name is methyl (1R)-6,6-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-ene-1-carboxylate.
| Compound Name | methyl (1R)-6,6-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 140813852 |
| Molecular Formula | C16H27BO4 |
| Molecular Weight | 294.20 g/mol |
| Exact Mass | 294.20 |
| IUPAC Name | methyl (1R)-6,6-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-ene-1-carboxylate |
| SMILES | COC(=O)[C@@H]1CC(B2OC(C)(C)C(C)(C)O2)=CCC1(C)C |
| InChI | InChI=1S/C16H27BO4/c1-14(2)9-8-11(10-12(14)13(18)19-7)17-20-15(3,4)16(5,6)21-17/h8,12H,9-10H2,1-7H3/t12-/m0/s1 |
| InChIKey | UAGJTJGQAYIKBP-LBPRGKRZSA-N |
| XLogP | 3.15 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.20 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|