C14H21BO4 — CID 123383225
methyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-2,4-diene-1-carboxylate (PubChem CID 123383225) has the molecular formula C14H21BO4 and a molecular weight of 264.13 g/mol. Its IUPAC name is methyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-2,4-diene-1-carboxylate.
| Compound Name | methyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-2,4-diene-1-carboxylate |
|---|---|
| PubChem CID | 123383225 |
| Molecular Formula | C14H21BO4 |
| Molecular Weight | 264.13 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | methyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-2,4-diene-1-carboxylate |
| SMILES | COC(=O)C1C=CC=C(B2OC(C)(C)C(C)(C)O2)C1 |
| InChI | InChI=1S/C14H21BO4/c1-13(2)14(3,4)19-15(18-13)11-8-6-7-10(9-11)12(16)17-5/h6-8,10H,9H2,1-5H3 |
| InChIKey | JAGRWPGFHBPUSO-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.13 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|