C14H24BNO4 — CID 174048069
(2S,6R)-2,6-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridine-1-carboxylic acid (PubChem CID 174048069) has the molecular formula C14H24BNO4 and a molecular weight of 281.16 g/mol. Its IUPAC name is (2S,6R)-2,6-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridine-1-carboxylic acid.
| Compound Name | (2S,6R)-2,6-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridine-1-carboxylic acid |
|---|---|
| PubChem CID | 174048069 |
| Molecular Formula | C14H24BNO4 |
| Molecular Weight | 281.16 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | (2S,6R)-2,6-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridine-1-carboxylic acid |
| SMILES | C[C@@H]1C=C(B2OC(C)(C)C(C)(C)O2)C[C@H](C)N1C(=O)O |
| InChI | InChI=1S/C14H24BNO4/c1-9-7-11(8-10(2)16(9)12(17)18)15-19-13(3,4)14(5,6)20-15/h7,9-10H,8H2,1-6H3,(H,17,18)/t9-,10+/m1/s1 |
| InChIKey | AFAVJYLMWDPBKN-ZJUUUORDSA-N |
| XLogP | 2.70 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.16 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|