C13H21BO4S — CID 171936694
3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-8λ6-thiabicyclo[3.2.1]oct-2-ene 8,8-dioxide (PubChem CID 171936694) has the molecular formula C13H21BO4S and a molecular weight of 284.19 g/mol. Its IUPAC name is 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-8λ6-thiabicyclo[3.2.1]oct-2-ene 8,8-dioxide.
| Compound Name | 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-8λ6-thiabicyclo[3.2.1]oct-2-ene 8,8-dioxide |
|---|---|
| PubChem CID | 171936694 |
| Molecular Formula | C13H21BO4S |
| Molecular Weight | 284.19 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-8λ6-thiabicyclo[3.2.1]oct-2-ene 8,8-dioxide |
| SMILES | CC1(C)OB(C2=CC3CCC(C2)S3(=O)=O)OC1(C)C |
| InChI | InChI=1S/C13H21BO4S/c1-12(2)13(3,4)18-14(17-12)9-7-10-5-6-11(8-9)19(10,15)16/h7,10-11H,5-6,8H2,1-4H3 |
| InChIKey | AEZXRUVICCCSOI-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.19 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|