C19H26BNO4S — CID 171969800
3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-9λ6-thiabicyclo[3.3.1]non-2-ene 9,9-dioxide (PubChem CID 171969800) has the molecular formula C19H26BNO4S and a molecular weight of 375.30 g/mol. Its IUPAC name is 3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-9λ6-thiabicyclo[3.3.1]non-2-ene 9,9-dioxide.
| Compound Name | 3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-9λ6-thiabicyclo[3.3.1]non-2-ene 9,9-dioxide |
|---|---|
| PubChem CID | 171969800 |
| Molecular Formula | C19H26BNO4S |
| Molecular Weight | 375.30 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-9λ6-thiabicyclo[3.3.1]non-2-ene 9,9-dioxide |
| SMILES | CC1(C)OB(c2cncc(C3=CC4CCCC(C3)S4(=O)=O)c2)OC1(C)C |
| InChI | InChI=1S/C19H26BNO4S/c1-18(2)19(3,4)25-20(24-18)15-8-14(11-21-12-15)13-9-16-6-5-7-17(10-13)26(16,22)23/h8-9,11-12,16-17H,5-7,10H2,1-4H3 |
| InChIKey | NQUGOOZGKLIXJE-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.30 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|