C14H20BNO3 — CID 174045263
3-(oxetan-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (PubChem CID 174045263) has the molecular formula C14H20BNO3 and a molecular weight of 261.13 g/mol. Its IUPAC name is 3-(oxetan-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
| Compound Name | 3-(oxetan-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
|---|---|
| PubChem CID | 174045263 |
| Molecular Formula | C14H20BNO3 |
| Molecular Weight | 261.13 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 3-(oxetan-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| SMILES | CC1(C)OB(c2cncc(C3CCO3)c2)OC1(C)C |
| InChI | InChI=1S/C14H20BNO3/c1-13(2)14(3,4)19-15(18-13)11-7-10(8-16-9-11)12-5-6-17-12/h7-9,12H,5-6H2,1-4H3 |
| InChIKey | QKFQWRRBXCIBJH-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.13 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|