C18H26BNO3S — CID 171953598
3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-8-thiabicyclo[3.2.1]octan-3-ol (PubChem CID 171953598) has the molecular formula C18H26BNO3S and a molecular weight of 347.29 g/mol. Its IUPAC name is 3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-8-thiabicyclo[3.2.1]octan-3-ol.
| Compound Name | 3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-8-thiabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 171953598 |
| Molecular Formula | C18H26BNO3S |
| Molecular Weight | 347.29 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-8-thiabicyclo[3.2.1]octan-3-ol |
| SMILES | CC1(C)OB(c2cncc(C3(O)CC4CCC(C3)S4)c2)OC1(C)C |
| InChI | InChI=1S/C18H26BNO3S/c1-16(2)17(3,4)23-19(22-16)13-7-12(10-20-11-13)18(21)8-14-5-6-15(9-18)24-14/h7,10-11,14-15,21H,5-6,8-9H2,1-4H3 |
| InChIKey | GTLJMHAJHIDBMU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.29 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|