C23H35BN2O5 — CID 171953593
tert-butyl 3-hydroxy-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 171953593) has the molecular formula C23H35BN2O5 and a molecular weight of 430.35 g/mol. Its IUPAC name is tert-butyl 3-hydroxy-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl 3-hydroxy-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 171953593 |
| Molecular Formula | C23H35BN2O5 |
| Molecular Weight | 430.35 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | tert-butyl 3-hydroxy-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CCC1CC(O)(c1cncc(B3OC(C)(C)C(C)(C)O3)c1)C2 |
| InChI | InChI=1S/C23H35BN2O5/c1-20(2,3)29-19(27)26-17-8-9-18(26)12-23(28,11-17)15-10-16(14-25-13-15)24-30-21(4,5)22(6,7)31-24/h10,13-14,17-18,28H,8-9,11-12H2,1-7H3 |
| InChIKey | GMPGPLPMXQBBCR-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.35 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|