C14H18BN3O3 — CID 170992305
2-methyl-5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-1,3,4-oxadiazole (PubChem CID 170992305) has the molecular formula C14H18BN3O3 and a molecular weight of 287.13 g/mol. Its IUPAC name is 2-methyl-5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-1,3,4-oxadiazole.
| Compound Name | 2-methyl-5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 170992305 |
| Molecular Formula | C14H18BN3O3 |
| Molecular Weight | 287.13 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 2-methyl-5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-1,3,4-oxadiazole |
| SMILES | Cc1nnc(-c2cncc(B3OC(C)(C)C(C)(C)O3)c2)o1 |
| InChI | InChI=1S/C14H18BN3O3/c1-9-17-18-12(19-9)10-6-11(8-16-7-10)15-20-13(2,3)14(4,5)21-15/h6-8H,1-5H3 |
| InChIKey | KYFRKOYFDZGBPP-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 70.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.13 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|