C15H19BN2O4 — CID 90102151
3-(5-methyl-1,3,4-oxadiazol-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol (PubChem CID 90102151) has the molecular formula C15H19BN2O4 and a molecular weight of 302.14 g/mol. Its IUPAC name is 3-(5-methyl-1,3,4-oxadiazol-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol.
| Compound Name | 3-(5-methyl-1,3,4-oxadiazol-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol |
|---|---|
| PubChem CID | 90102151 |
| Molecular Formula | C15H19BN2O4 |
| Molecular Weight | 302.14 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 3-(5-methyl-1,3,4-oxadiazol-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol |
| SMILES | Cc1nnc(-c2cc(O)cc(B3OC(C)(C)C(C)(C)O3)c2)o1 |
| InChI | InChI=1S/C15H19BN2O4/c1-9-17-18-13(20-9)10-6-11(8-12(19)7-10)16-21-14(2,3)15(4,5)22-16/h6-8,19H,1-5H3 |
| InChIKey | FNTSLPBGLKQQKI-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 77.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.14 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|