C19H25BO4S — CID 171971398
3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-8λ6-thiabicyclo[3.2.1]oct-2-ene 8,8-dioxide (PubChem CID 171971398) has the molecular formula C19H25BO4S and a molecular weight of 360.28 g/mol. Its IUPAC name is 3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-8λ6-thiabicyclo[3.2.1]oct-2-ene 8,8-dioxide.
| Compound Name | 3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-8λ6-thiabicyclo[3.2.1]oct-2-ene 8,8-dioxide |
|---|---|
| PubChem CID | 171971398 |
| Molecular Formula | C19H25BO4S |
| Molecular Weight | 360.28 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-8λ6-thiabicyclo[3.2.1]oct-2-ene 8,8-dioxide |
| SMILES | CC1(C)OB(c2cccc(C3=CC4CCC(C3)S4(=O)=O)c2)OC1(C)C |
| InChI | InChI=1S/C19H25BO4S/c1-18(2)19(3,4)24-20(23-18)15-7-5-6-13(10-15)14-11-16-8-9-17(12-14)25(16,21)22/h5-7,10-11,16-17H,8-9,12H2,1-4H3 |
| InChIKey | BBZIKRXSOQBCMU-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.28 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|