C19H25BO2S — CID 171973077
4,4,5,5-tetramethyl-2-[3-(8-thiabicyclo[3.2.1]oct-2-en-3-yl)phenyl]-1,3,2-dioxaborolane (PubChem CID 171973077) has the molecular formula C19H25BO2S and a molecular weight of 328.29 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[3-(8-thiabicyclo[3.2.1]oct-2-en-3-yl)phenyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[3-(8-thiabicyclo[3.2.1]oct-2-en-3-yl)phenyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 171973077 |
| Molecular Formula | C19H25BO2S |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[3-(8-thiabicyclo[3.2.1]oct-2-en-3-yl)phenyl]-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2cccc(C3=CC4CCC(C3)S4)c2)OC1(C)C |
| InChI | InChI=1S/C19H25BO2S/c1-18(2)19(3,4)22-20(21-18)15-7-5-6-13(10-15)14-11-16-8-9-17(12-14)23-16/h5-7,10-11,16-17H,8-9,12H2,1-4H3 |
| InChIKey | PIHPXXHAEWIMJQ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|