C20H27BO4S — CID 171970058
3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-9λ6-thiabicyclo[3.3.1]non-2-ene 9,9-dioxide (PubChem CID 171970058) has the molecular formula C20H27BO4S and a molecular weight of 374.31 g/mol. Its IUPAC name is 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-9λ6-thiabicyclo[3.3.1]non-2-ene 9,9-dioxide.
| Compound Name | 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-9λ6-thiabicyclo[3.3.1]non-2-ene 9,9-dioxide |
|---|---|
| PubChem CID | 171970058 |
| Molecular Formula | C20H27BO4S |
| Molecular Weight | 374.31 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-9λ6-thiabicyclo[3.3.1]non-2-ene 9,9-dioxide |
| SMILES | CC1(C)OB(c2ccc(C3=CC4CCCC(C3)S4(=O)=O)cc2)OC1(C)C |
| InChI | InChI=1S/C20H27BO4S/c1-19(2)20(3,4)25-21(24-19)16-10-8-14(9-11-16)15-12-17-6-5-7-18(13-15)26(17,22)23/h8-12,17-18H,5-7,13H2,1-4H3 |
| InChIKey | DSXYQFJYPGSQEK-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.31 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|