C26H25NO2S — CID 171967576
4-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]non-2-en-3-yl)-N,N-diphenylaniline (PubChem CID 171967576) has the molecular formula C26H25NO2S and a molecular weight of 415.56 g/mol. Its IUPAC name is 4-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]non-2-en-3-yl)-N,N-diphenylaniline.
| Compound Name | 4-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]non-2-en-3-yl)-N,N-diphenylaniline |
|---|---|
| PubChem CID | 171967576 |
| Molecular Formula | C26H25NO2S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 4-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]non-2-en-3-yl)-N,N-diphenylaniline |
| SMILES | O=S1(=O)C2C=C(c3ccc(N(c4ccccc4)c4ccccc4)cc3)CC1CCC2 |
| InChI | InChI=1S/C26H25NO2S/c28-30(29)25-12-7-13-26(30)19-21(18-25)20-14-16-24(17-15-20)27(22-8-3-1-4-9-22)23-10-5-2-6-11-23/h1-6,8-11,14-18,25-26H,7,12-13,19H2 |
| InChIKey | MRZVKMBJLUSLIV-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |