C15H22BNO3 — CID 123830995
6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4,4a,8a-tetrahydro-1H-quinolin-2-one (PubChem CID 123830995) has the molecular formula C15H22BNO3 and a molecular weight of 275.16 g/mol. Its IUPAC name is 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4,4a,8a-tetrahydro-1H-quinolin-2-one.
| Compound Name | 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4,4a,8a-tetrahydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 123830995 |
| Molecular Formula | C15H22BNO3 |
| Molecular Weight | 275.16 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4,4a,8a-tetrahydro-1H-quinolin-2-one |
| SMILES | CC1(C)OB(C2=CC3CCC(=O)NC3C=C2)OC1(C)C |
| InChI | InChI=1S/C15H22BNO3/c1-14(2)15(3,4)20-16(19-14)11-6-7-12-10(9-11)5-8-13(18)17-12/h6-7,9-10,12H,5,8H2,1-4H3,(H,17,18) |
| InChIKey | JVTFKJSSWLRLOF-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.16 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|