C14H21BN2O3 — CID 144667568
2-[6-amino-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-2,4-dien-1-yl]-2-iminoacetaldehyde (PubChem CID 144667568) has the molecular formula C14H21BN2O3 and a molecular weight of 276.14 g/mol. Its IUPAC name is 2-[6-amino-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-2,4-dien-1-yl]-2-iminoacetaldehyde.
| Compound Name | 2-[6-amino-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-2,4-dien-1-yl]-2-iminoacetaldehyde |
|---|---|
| PubChem CID | 144667568 |
| Molecular Formula | C14H21BN2O3 |
| Molecular Weight | 276.14 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 2-[6-amino-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-2,4-dien-1-yl]-2-iminoacetaldehyde |
| SMILES | [H]/N=C(\C=O)C1C=C(B2OC(C)(C)C(C)(C)O2)C=CC1N |
| InChI | InChI=1S/C14H21BN2O3/c1-13(2)14(3,4)20-15(19-13)9-5-6-11(16)10(7-9)12(17)8-18/h5-8,10-11,17H,16H2,1-4H3/b17-12+ |
| InChIKey | AZSFQQVYGCHRDR-SFQUDFHCSA-N |
| XLogP | 1.28 |
| TPSA | 85.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.14 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|