C16H23BN2O3 — CID 174083976
(1R)-1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9,10-diazatricyclo[5.3.0.02,10]deca-3,5-diene-8-carbaldehyde (PubChem CID 174083976) has the molecular formula C16H23BN2O3 and a molecular weight of 302.18 g/mol. Its IUPAC name is (1R)-1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9,10-diazatricyclo[5.3.0.02,10]deca-3,5-diene-8-carbaldehyde.
| Compound Name | (1R)-1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9,10-diazatricyclo[5.3.0.02,10]deca-3,5-diene-8-carbaldehyde |
|---|---|
| PubChem CID | 174083976 |
| Molecular Formula | C16H23BN2O3 |
| Molecular Weight | 302.18 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | (1R)-1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9,10-diazatricyclo[5.3.0.02,10]deca-3,5-diene-8-carbaldehyde |
| SMILES | CC1(C)OB(C2=CC3C(C=O)NN4C(C=C2)[C@@]34C)OC1(C)C |
| InChI | InChI=1S/C16H23BN2O3/c1-14(2)15(3,4)22-17(21-14)10-6-7-13-16(5)11(8-10)12(9-20)18-19(13)16/h6-9,11-13,18H,1-5H3/t11?,12?,13?,16-,19?/m1/s1 |
| InChIKey | WKADORICDPZFDA-FVTZREDMSA-N |
| XLogP | 1.26 |
| TPSA | 50.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.18 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|