C12H22BNO2 — CID 166476928
3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,3,6-tetrahydropyridine (PubChem CID 166476928) has the molecular formula C12H22BNO2 and a molecular weight of 223.12 g/mol. Its IUPAC name is 3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,3,6-tetrahydropyridine.
| Compound Name | 3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 166476928 |
| Molecular Formula | C12H22BNO2 |
| Molecular Weight | 223.12 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,3,6-tetrahydropyridine |
| SMILES | CC1CNCC=C1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C12H22BNO2/c1-9-8-14-7-6-10(9)13-15-11(2,3)12(4,5)16-13/h6,9,14H,7-8H2,1-5H3 |
| InChIKey | QTEPBHYOPNITNX-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.12 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|