C13H20BNO2S — CID 123903940
7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4,9-dihydro-1,3-thiazonine (PubChem CID 123903940) has the molecular formula C13H20BNO2S and a molecular weight of 265.19 g/mol. Its IUPAC name is 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4,9-dihydro-1,3-thiazonine.
| Compound Name | 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4,9-dihydro-1,3-thiazonine |
|---|---|
| PubChem CID | 123903940 |
| Molecular Formula | C13H20BNO2S |
| Molecular Weight | 265.19 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4,9-dihydro-1,3-thiazonine |
| SMILES | CC1(C)OB(C2=CCS/C=N\CC=C2)OC1(C)C |
| InChI | InChI=1S/C13H20BNO2S/c1-12(2)13(3,4)17-14(16-12)11-6-5-8-15-10-18-9-7-11/h5-7,10H,8-9H2,1-4H3/b6-5?,11-7?,15-10- |
| InChIKey | HREUENSVZWQIBQ-RZMRDAJXSA-N |
| XLogP | 2.88 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.19 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|