C22H25BN2O2 — CID 160510610
7H-cyclopenta[b]pyridine;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-7H-cyclopenta[b]pyridine (PubChem CID 160510610) has the molecular formula C22H25BN2O2 and a molecular weight of 360.27 g/mol. Its IUPAC name is 7H-cyclopenta[b]pyridine;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-7H-cyclopenta[b]pyridine.
| Compound Name | 7H-cyclopenta[b]pyridine;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-7H-cyclopenta[b]pyridine |
|---|---|
| PubChem CID | 160510610 |
| Molecular Formula | C22H25BN2O2 |
| Molecular Weight | 360.27 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 7H-cyclopenta[b]pyridine;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-7H-cyclopenta[b]pyridine |
| SMILES | C1=Cc2cccnc2C1.CC1(C)OB(C2=CCc3ncccc32)OC1(C)C |
| InChI | InChI=1S/C14H18BNO2.C8H7N/c1-13(2)14(3,4)18-15(17-13)11-7-8-12-10(11)6-5-9-16-12;1-3-7-4-2-6-9-8(7)5-1/h5-7,9H,8H2,1-4H3;1-4,6H,5H2 |
| InChIKey | QSZOTDVCQNVVDE-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.27 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|