C14H19BN2O2 — CID 143838083
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,6-dihydropyrrolo[2,3-b]azepine (PubChem CID 143838083) has the molecular formula C14H19BN2O2 and a molecular weight of 258.13 g/mol. Its IUPAC name is 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,6-dihydropyrrolo[2,3-b]azepine.
| Compound Name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,6-dihydropyrrolo[2,3-b]azepine |
|---|---|
| PubChem CID | 143838083 |
| Molecular Formula | C14H19BN2O2 |
| Molecular Weight | 258.13 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,6-dihydropyrrolo[2,3-b]azepine |
| SMILES | CC1(C)OB(C2=CCC=Nc3[nH]ccc32)OC1(C)C |
| InChI | InChI=1S/C14H19BN2O2/c1-13(2)14(3,4)19-15(18-13)11-6-5-8-16-12-10(11)7-9-17-12/h6-9,17H,5H2,1-4H3 |
| InChIKey | QSVICABDVDPDAS-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 46.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.13 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|