C16H23BN2O2S — CID 143565826
N-methyl-N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indol-6-yl]sulfanyl]methanamine (PubChem CID 143565826) has the molecular formula C16H23BN2O2S and a molecular weight of 318.25 g/mol. Its IUPAC name is N-methyl-N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indol-6-yl]sulfanyl]methanamine.
| Compound Name | N-methyl-N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indol-6-yl]sulfanyl]methanamine |
|---|---|
| PubChem CID | 143565826 |
| Molecular Formula | C16H23BN2O2S |
| Molecular Weight | 318.25 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | N-methyl-N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indol-6-yl]sulfanyl]methanamine |
| SMILES | CN(C)Sc1cc(B2OC(C)(C)C(C)(C)O2)c2cc[nH]c2c1 |
| InChI | InChI=1S/C16H23BN2O2S/c1-15(2)16(3,4)21-17(20-15)13-9-11(22-19(5)6)10-14-12(13)7-8-18-14/h7-10,18H,1-6H3 |
| InChIKey | BPLYFMXPFZJDEI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 37.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.25 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|