C40H46BBrN2O2 — CID 162055126
1-bromo-2-propan-2-ylbenzene;4-(2-propan-2-ylphenyl)-1H-indole;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole (PubChem CID 162055126) has the molecular formula C40H46BBrN2O2 and a molecular weight of 677.54 g/mol. Its IUPAC name is 1-bromo-2-propan-2-ylbenzene;4-(2-propan-2-ylphenyl)-1H-indole;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole.
| Compound Name | 1-bromo-2-propan-2-ylbenzene;4-(2-propan-2-ylphenyl)-1H-indole;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole |
|---|---|
| PubChem CID | 162055126 |
| Molecular Formula | C40H46BBrN2O2 |
| Molecular Weight | 677.54 g/mol |
| Exact Mass | 676.28 |
| IUPAC Name | 1-bromo-2-propan-2-ylbenzene;4-(2-propan-2-ylphenyl)-1H-indole;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole |
| SMILES | CC(C)c1ccccc1-c1cccc2[nH]ccc12.CC(C)c1ccccc1Br.CC1(C)OB(c2cccc3[nH]ccc23)OC1(C)C |
| InChI | InChI=1S/C17H17N.C14H18BNO2.C9H11Br/c1-12(2)13-6-3-4-7-14(13)15-8-5-9-17-16(15)10-11-18-17;1-13(2)14(3,4)18-15(17-13)11-6-5-7-12-10(11)8-9-16-12;1-7(2)8-5-3-4-6-9(8)10/h3-12,18H,1-2H3;5-9,16H,1-4H3;3-7H,1-2H3 |
| InChIKey | YZBNOLJDZBZAMB-UHFFFAOYSA-N |
| XLogP | 11.00 |
| TPSA | 50.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.54 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|