C26H28BBrN2O2 — CID 160674054
5-bromo-2-methylquinoline;2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline (PubChem CID 160674054) has the molecular formula C26H28BBrN2O2 and a molecular weight of 491.24 g/mol. Its IUPAC name is 5-bromo-2-methylquinoline;2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline.
| Compound Name | 5-bromo-2-methylquinoline;2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline |
|---|---|
| PubChem CID | 160674054 |
| Molecular Formula | C26H28BBrN2O2 |
| Molecular Weight | 491.24 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | 5-bromo-2-methylquinoline;2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline |
| SMILES | Cc1ccc2c(B3OC(C)(C)C(C)(C)O3)cccc2n1.Cc1ccc2c(Br)cccc2n1 |
| InChI | InChI=1S/C16H20BNO2.C10H8BrN/c1-11-9-10-12-13(7-6-8-14(12)18-11)17-19-15(2,3)16(4,5)20-17;1-7-5-6-8-9(11)3-2-4-10(8)12-7/h6-10H,1-5H3;2-6H,1H3 |
| InChIKey | RNHLSDKZJZCAAU-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.24 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|